C21H32 — CID 18941814
1,2,3,5,5-pentamethyl-4-[(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene (PubChem CID 18941814) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethyl-4-[(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene.
| Compound Name | 1,2,3,5,5-pentamethyl-4-[(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 18941814 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1,2,3,5,5-pentamethyl-4-[(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)(C)C(CC2=C(C)C(C)=C(C)C2(C)C)=C1C |
| InChI | InChI=1S/C21H32/c1-12-14(3)18(20(7,8)16(12)5)11-19-15(4)13(2)17(6)21(19,9)10/h11H2,1-10H3 |
| InChIKey | BWFOCUXRJJSDGL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |