About 3-butanoylsulfanylhexyl butanoate
3-butanoylsulfanylhexyl butanoate (PubChem CID 18941862) has the molecular formula C14H26O3S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 3-butanoylsulfanylhexyl butanoate.
Molecular Properties
| Compound Name | 3-butanoylsulfanylhexyl butanoate |
| PubChem CID | 18941862 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-butanoylsulfanylhexyl butanoate |
| SMILES | CCCC(=O)OCCC(CCC)SC(=O)CCC |
| InChI | InChI=1S/C14H26O3S/c1-4-7-12(18-14(16)9-6-3)10-11-17-13(15)8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | IAAVYXKIYUAQRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-butanoylsulfanylhexyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butanoylsulfanylhexyl butanoate?
The IUPAC name of 3-butanoylsulfanylhexyl butanoate (CID 18941862) is 3-butanoylsulfanylhexyl butanoate.
What is the SMILES notation for 3-butanoylsulfanylhexyl butanoate?
The canonical SMILES for 3-butanoylsulfanylhexyl butanoate is CCCC(=O)OCCC(CCC)SC(=O)CCC.
What is the InChIKey of 3-butanoylsulfanylhexyl butanoate?
The InChIKey is IAAVYXKIYUAQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3S/c1-4-7-12(18-14(16)9-6-3)10-11-17-13(15)8-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 3-butanoylsulfanylhexyl butanoate?
3-butanoylsulfanylhexyl butanoate has a molecular weight of 274.43 g/mol, XLogP of 3.95, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butanoylsulfanylhexyl butanoate is sourced from PubChem (CID 18941862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).