C10H16N4O3S2 — CID 18941993
[4,4-dimethyl-1-oxo-1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]pentan-3-yl]carbamic acid (PubChem CID 18941993) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is [4,4-dimethyl-1-oxo-1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]pentan-3-yl]carbamic acid.
| Compound Name | [4,4-dimethyl-1-oxo-1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]pentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 18941993 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [4,4-dimethyl-1-oxo-1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]pentan-3-yl]carbamic acid |
| SMILES | CC(C)(C)C(CC(=O)Nc1n[nH]c(=S)s1)NC(=O)O |
| InChI | InChI=1S/C10H16N4O3S2/c1-10(2,3)5(11-8(16)17)4-6(15)12-7-13-14-9(18)19-7/h5,11H,4H2,1-3H3,(H,14,18)(H,16,17)(H,12,13,15) |
| InChIKey | KYUKPXFAXJKZOK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|