methyl 3-bromo-5-(trifluoromethyl)benzoate

C9H6BrF3O2 — CID 18942156

IUPACmethyl 3-bromo-5-(trifluoromethyl)benzoate
SMILESCOC(=O)c1cc(Br)cc(C(F)(F)F)c1
InChIInChI=1S/C9H6BrF3O2/c1-15-8(14)5-2-6(9(11,12)13)4-7(10)3-5/h2-4H,1H3
InChIKeyCHJZZYDOCDJKFY-UHFFFAOYSA-N
MW283.04 g/mol
LogP3.25
Rot. Bonds1

About methyl 3-bromo-5-(trifluoromethyl)benzoate

methyl 3-bromo-5-(trifluoromethyl)benzoate (PubChem CID 18942156) has the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. Its IUPAC name is methyl 3-bromo-5-(trifluoromethyl)benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-5-(trifluoromethyl)benzoate
PubChem CID18942156
Molecular FormulaC9H6BrF3O2
Molecular Weight283.04 g/mol
Exact Mass281.95
IUPAC Namemethyl 3-bromo-5-(trifluoromethyl)benzoate
SMILESCOC(=O)c1cc(Br)cc(C(F)(F)F)c1
InChIInChI=1S/C9H6BrF3O2/c1-15-8(14)5-2-6(9(11,12)13)4-7(10)3-5/h2-4H,1H3
InChIKeyCHJZZYDOCDJKFY-UHFFFAOYSA-N
XLogP3.25
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.04
LogP ≤ 53.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-bromo-5-(trifluoromethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-5-(trifluoromethyl)benzoate?
The IUPAC name of methyl 3-bromo-5-(trifluoromethyl)benzoate (CID 18942156) is methyl 3-bromo-5-(trifluoromethyl)benzoate.
What is the SMILES notation for methyl 3-bromo-5-(trifluoromethyl)benzoate?
The canonical SMILES for methyl 3-bromo-5-(trifluoromethyl)benzoate is COC(=O)c1cc(Br)cc(C(F)(F)F)c1.
What is the InChIKey of methyl 3-bromo-5-(trifluoromethyl)benzoate?
The InChIKey is CHJZZYDOCDJKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF3O2/c1-15-8(14)5-2-6(9(11,12)13)4-7(10)3-5/h2-4H,1H3.
What are the key properties of methyl 3-bromo-5-(trifluoromethyl)benzoate?
methyl 3-bromo-5-(trifluoromethyl)benzoate has a molecular weight of 283.04 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-5-(trifluoromethyl)benzoate is sourced from PubChem (CID 18942156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).