About methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate
methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate (PubChem CID 18942530) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate.
Molecular Properties
| Compound Name | methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate |
| PubChem CID | 18942530 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate |
| SMILES | COC(=O)CCCCC1=NCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-12-9(11)5-3-2-4-8-10-6-7-13-8/h2-7H2,1H3 |
| InChIKey | NNKHPULWRGNPNR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate?
The IUPAC name of methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate (CID 18942530) is methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate.
What is the SMILES notation for methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate?
The canonical SMILES for methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate is COC(=O)CCCCC1=NCCO1.
What is the InChIKey of methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate?
The InChIKey is NNKHPULWRGNPNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-12-9(11)5-3-2-4-8-10-6-7-13-8/h2-7H2,1H3.
What are the key properties of methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate?
methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate has a molecular weight of 185.22 g/mol, XLogP of 1.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4,5-dihydro-1,3-oxazol-2-yl)pentanoate is sourced from PubChem (CID 18942530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).