About furan;1H-pyrrole;thiophene
furan;1H-pyrrole;thiophene (PubChem CID 18943047) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is furan;1H-pyrrole;thiophene.
Molecular Properties
| Compound Name | furan;1H-pyrrole;thiophene |
| PubChem CID | 18943047 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | furan;1H-pyrrole;thiophene |
| SMILES | c1cc[nH]c1.c1ccoc1.c1ccsc1 |
| InChI | InChI=1S/C4H5N.C4H4O.C4H4S/c3*1-2-4-5-3-1/h1-5H;2*1-4H |
| InChIKey | ANHOUBYKJPFVAX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze furan;1H-pyrrole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;1H-pyrrole;thiophene?
The IUPAC name of furan;1H-pyrrole;thiophene (CID 18943047) is furan;1H-pyrrole;thiophene.
What is the SMILES notation for furan;1H-pyrrole;thiophene?
The canonical SMILES for furan;1H-pyrrole;thiophene is c1cc[nH]c1.c1ccoc1.c1ccsc1.
What is the InChIKey of furan;1H-pyrrole;thiophene?
The InChIKey is ANHOUBYKJPFVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N.C4H4O.C4H4S/c3*1-2-4-5-3-1/h1-5H;2*1-4H.
What are the key properties of furan;1H-pyrrole;thiophene?
furan;1H-pyrrole;thiophene has a molecular weight of 219.31 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan;1H-pyrrole;thiophene is sourced from PubChem (CID 18943047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).