C13H14O5 — CID 18943085
2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carbaldehyde (PubChem CID 18943085) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carbaldehyde.
| Compound Name | 2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carbaldehyde |
|---|---|
| PubChem CID | 18943085 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carbaldehyde |
| SMILES | CC1(C)Oc2cc3c(c(C=O)c2O1)OC(C)(C)O3 |
| InChI | InChI=1S/C13H14O5/c1-12(2)15-8-5-9-11(18-13(3,4)16-9)7(6-14)10(8)17-12/h5-6H,1-4H3 |
| InChIKey | QEOCTFAMNQNQRN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|