C25H30F3N3O5 — CID 18943456
methyl 3-[4-[2,4-dioxo-3-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoate (PubChem CID 18943456) has the molecular formula C25H30F3N3O5 and a molecular weight of 509.53 g/mol. Its IUPAC name is methyl 3-[4-[2,4-dioxo-3-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoate.
| Compound Name | methyl 3-[4-[2,4-dioxo-3-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 18943456 |
| Molecular Formula | C25H30F3N3O5 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | methyl 3-[4-[2,4-dioxo-3-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoate |
| SMILES | COC(=O)CCC1CCC(N2CC(=O)N(c3ccc4c(c3)CCN(C(=O)C(F)(F)F)CC4)C2=O)CC1 |
| InChI | InChI=1S/C25H30F3N3O5/c1-36-22(33)9-4-16-2-6-19(7-3-16)30-15-21(32)31(24(30)35)20-8-5-17-10-12-29(13-11-18(17)14-20)23(34)25(26,27)28/h5,8,14,16,19H,2-4,6-7,9-13,15H2,1H3 |
| InChIKey | YRQOUJRGAFVYTJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|