C11H16N2O — CID 18943478
7-ethyl-5,6,8,9-tetrahydro-2H-pyrido[3,4-d]azepin-3-one (PubChem CID 18943478) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 7-ethyl-5,6,8,9-tetrahydro-2H-pyrido[3,4-d]azepin-3-one.
| Compound Name | 7-ethyl-5,6,8,9-tetrahydro-2H-pyrido[3,4-d]azepin-3-one |
|---|---|
| PubChem CID | 18943478 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 7-ethyl-5,6,8,9-tetrahydro-2H-pyrido[3,4-d]azepin-3-one |
| SMILES | CCN1CCc2c[nH]c(=O)cc2CC1 |
| InChI | InChI=1S/C11H16N2O/c1-2-13-5-3-9-7-11(14)12-8-10(9)4-6-13/h7-8H,2-6H2,1H3,(H,12,14) |
| InChIKey | QWRTUGNCHMMFGI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |