C24H38O7 — CID 18943852
7-[8-(3,3-dimethylbutanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 18943852) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is 7-[8-(3,3-dimethylbutanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[8-(3,3-dimethylbutanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 18943852 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 7-[8-(3,3-dimethylbutanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC1C=CC2=CC(O)CC(OC(=O)CC(C)(C)C)C2C1CCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C24H38O7/c1-14-5-6-15-9-17(26)11-20(31-22(30)13-24(2,3)4)23(15)19(14)8-7-16(25)10-18(27)12-21(28)29/h5-6,9,14,16-20,23,25-27H,7-8,10-13H2,1-4H3,(H,28,29) |
| InChIKey | KTYVAVHJWQFZOH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |