C28H42O6 — CID 18943866
7-[8-(2-ethyl-2-prop-2-enylpent-4-enoyl)oxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 18943866) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is 7-[8-(2-ethyl-2-prop-2-enylpent-4-enoyl)oxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[8-(2-ethyl-2-prop-2-enylpent-4-enoyl)oxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 18943866 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 7-[8-(2-ethyl-2-prop-2-enylpent-4-enoyl)oxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | C=CCC(CC)(CC=C)C(=O)OC1CCC=C2C=CC(C)C(CCC(O)CC(O)CC(=O)O)C21 |
| InChI | InChI=1S/C28H42O6/c1-5-15-28(7-3,16-6-2)27(33)34-24-10-8-9-20-12-11-19(4)23(26(20)24)14-13-21(29)17-22(30)18-25(31)32/h5-6,9,11-12,19,21-24,26,29-30H,1-2,7-8,10,13-18H2,3-4H3,(H,31,32) |
| InChIKey | ISWLMBDANZANBW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|