C23H36O7 — CID 18943885
7-[8-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 18943885) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is 7-[8-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[8-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 18943885 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 7-[8-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC1C=CC2=CC(O)CC(OC(=O)C(C)(C)C)C2C1CCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C23H36O7/c1-13-5-6-14-9-16(25)11-19(30-22(29)23(2,3)4)21(14)18(13)8-7-15(24)10-17(26)12-20(27)28/h5-6,9,13,15-19,21,24-26H,7-8,10-12H2,1-4H3,(H,27,28) |
| InChIKey | JFIYCWRHVLOHQC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |