C32H34F3N3O2 — CID 18944286
9-[4-(3-benzamidopyrrolidin-1-yl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18944286) has the molecular formula C32H34F3N3O2 and a molecular weight of 549.64 g/mol. Its IUPAC name is 9-[4-(3-benzamidopyrrolidin-1-yl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(3-benzamidopyrrolidin-1-yl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18944286 |
| Molecular Formula | C32H34F3N3O2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 9-[4-(3-benzamidopyrrolidin-1-yl)pentyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | CC(CCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)N1CCC(NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C32H34F3N3O2/c1-22(38-19-17-24(20-38)37-29(39)23-11-3-2-4-12-23)10-9-18-31(30(40)36-21-32(33,34)35)27-15-7-5-13-25(27)26-14-6-8-16-28(26)31/h2-8,11-16,22,24H,9-10,17-21H2,1H3,(H,36,40)(H,37,39) |
| InChIKey | RADAHMASFYVHIV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |