C31H30F3N3O3 — CID 18944297
9-[4-(3-benzamido-2-oxopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18944297) has the molecular formula C31H30F3N3O3 and a molecular weight of 549.59 g/mol. Its IUPAC name is 9-[4-(3-benzamido-2-oxopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(3-benzamido-2-oxopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18944297 |
| Molecular Formula | C31H30F3N3O3 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 9-[4-(3-benzamido-2-oxopyrrolidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1=O)c1ccccc1 |
| InChI | InChI=1S/C31H30F3N3O3/c32-31(33,34)20-35-29(40)30(24-14-6-4-12-22(24)23-13-5-7-15-25(23)30)17-8-9-18-37-19-16-26(28(37)39)36-27(38)21-10-2-1-3-11-21/h1-7,10-15,26H,8-9,16-20H2,(H,35,40)(H,36,38) |
| InChIKey | BJXLZEDNXXWOHZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|