C31H30F5N3O2 — CID 18944305
9-[4-(3-benzamidopyrrolidin-1-yl)butyl]-3,6-difluoro-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18944305) has the molecular formula C31H30F5N3O2 and a molecular weight of 571.59 g/mol. Its IUPAC name is 9-[4-(3-benzamidopyrrolidin-1-yl)butyl]-3,6-difluoro-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-(3-benzamidopyrrolidin-1-yl)butyl]-3,6-difluoro-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18944305 |
| Molecular Formula | C31H30F5N3O2 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 9-[4-(3-benzamidopyrrolidin-1-yl)butyl]-3,6-difluoro-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccc(F)cc3-c3cc(F)ccc32)C1)c1ccccc1 |
| InChI | InChI=1S/C31H30F5N3O2/c32-21-8-10-26-24(16-21)25-17-22(33)9-11-27(25)30(26,29(41)37-19-31(34,35)36)13-4-5-14-39-15-12-23(18-39)38-28(40)20-6-2-1-3-7-20/h1-3,6-11,16-17,23H,4-5,12-15,18-19H2,(H,37,41)(H,38,40) |
| InChIKey | DQSDZENRDGHDGG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|