About 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene
5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene (PubChem CID 18944754) has the molecular formula C6H4F2N2O4
and a molecular weight of 206.10 g/mol. Its IUPAC name is 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene |
| PubChem CID | 18944754 |
| Molecular Formula | C6H4F2N2O4 |
| Molecular Weight | 206.10 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC(F)([N+](=O)[O-])C(F)C=C1 |
| InChI | InChI=1S/C6H4F2N2O4/c7-5-2-1-4(9(11)12)3-6(5,8)10(13)14/h1-3,5H |
| InChIKey | GKDLJMCWSRDIDC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.10 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene?
The IUPAC name of 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene (CID 18944754) is 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene.
What is the SMILES notation for 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene?
The canonical SMILES for 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene is O=[N+]([O-])C1=CC(F)([N+](=O)[O-])C(F)C=C1.
What is the InChIKey of 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene?
The InChIKey is GKDLJMCWSRDIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2N2O4/c7-5-2-1-4(9(11)12)3-6(5,8)10(13)14/h1-3,5H.
What are the key properties of 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene?
5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene has a molecular weight of 206.10 g/mol, XLogP of 1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-2,6-dinitrocyclohexa-1,3-diene is sourced from PubChem (CID 18944754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).