2-ethoxybenzenesulfonyl chloride

C8H9ClO3S — CID 18944993

IUPAC2-ethoxybenzenesulfonyl chloride
SMILESCCOc1ccccc1S(=O)(=O)Cl
InChIInChI=1S/C8H9ClO3S/c1-2-12-7-5-3-4-6-8(7)13(9,10)11/h3-6H,2H2,1H3
InChIKeyRWURYJNJYODVAL-UHFFFAOYSA-N
MW220.68 g/mol
LogP2.01
Rot. Bonds3

About 2-ethoxybenzenesulfonyl chloride

2-ethoxybenzenesulfonyl chloride (PubChem CID 18944993) has the molecular formula C8H9ClO3S and a molecular weight of 220.68 g/mol. Its IUPAC name is 2-ethoxybenzenesulfonyl chloride.

Molecular Properties

Compound Name2-ethoxybenzenesulfonyl chloride
PubChem CID18944993
Molecular FormulaC8H9ClO3S
Molecular Weight220.68 g/mol
Exact Mass220.00
IUPAC Name2-ethoxybenzenesulfonyl chloride
SMILESCCOc1ccccc1S(=O)(=O)Cl
InChIInChI=1S/C8H9ClO3S/c1-2-12-7-5-3-4-6-8(7)13(9,10)11/h3-6H,2H2,1H3
InChIKeyRWURYJNJYODVAL-UHFFFAOYSA-N
XLogP2.01
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.68
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-ethoxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxybenzenesulfonyl chloride?
The IUPAC name of 2-ethoxybenzenesulfonyl chloride (CID 18944993) is 2-ethoxybenzenesulfonyl chloride.
What is the SMILES notation for 2-ethoxybenzenesulfonyl chloride?
The canonical SMILES for 2-ethoxybenzenesulfonyl chloride is CCOc1ccccc1S(=O)(=O)Cl.
What is the InChIKey of 2-ethoxybenzenesulfonyl chloride?
The InChIKey is RWURYJNJYODVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO3S/c1-2-12-7-5-3-4-6-8(7)13(9,10)11/h3-6H,2H2,1H3.
What are the key properties of 2-ethoxybenzenesulfonyl chloride?
2-ethoxybenzenesulfonyl chloride has a molecular weight of 220.68 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzenesulfonyl chloride is sourced from PubChem (CID 18944993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).