C15H14N8O2 — CID 18945260
5-(2-cyanopyrrol-1-yl)-1-N,3-N-bis(diaminomethylidene)benzene-1,3-dicarboxamide (PubChem CID 18945260) has the molecular formula C15H14N8O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 5-(2-cyanopyrrol-1-yl)-1-N,3-N-bis(diaminomethylidene)benzene-1,3-dicarboxamide.
| Compound Name | 5-(2-cyanopyrrol-1-yl)-1-N,3-N-bis(diaminomethylidene)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 18945260 |
| Molecular Formula | C15H14N8O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-(2-cyanopyrrol-1-yl)-1-N,3-N-bis(diaminomethylidene)benzene-1,3-dicarboxamide |
| SMILES | N#Cc1cccn1-c1cc(C(=O)N=C(N)N)cc(C(=O)N=C(N)N)c1 |
| InChI | InChI=1S/C15H14N8O2/c16-7-10-2-1-3-23(10)11-5-8(12(24)21-14(17)18)4-9(6-11)13(25)22-15(19)20/h1-6H,(H4,17,18,21,24)(H4,19,20,22,25) |
| InChIKey | ILWCSAPSAQONFI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|