C32H37F3O9S2 — CID 18945727
bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate (PubChem CID 18945727) has the molecular formula C32H37F3O9S2 and a molecular weight of 686.77 g/mol. Its IUPAC name is bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate.
| Compound Name | bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 18945727 |
| Molecular Formula | C32H37F3O9S2 |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | bis[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cccc([S+](c2ccccc2)c2cccc(OCC(=O)OC(C)(C)C)c2)c1.O=S(=O)([O-])CC(F)(F)F |
| InChI | InChI=1S/C30H35O6S.C2H3F3O3S/c1-29(2,3)35-27(31)20-33-22-12-10-16-25(18-22)37(24-14-8-7-9-15-24)26-17-11-13-23(19-26)34-21-28(32)36-30(4,5)6;3-2(4,5)1-9(6,7)8/h7-19H,20-21H2,1-6H3;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | KKXDYWLLPZOLCI-UHFFFAOYSA-M |
| XLogP | 6.32 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|