C28H29F3O7S2 — CID 18945731
bis[4-(oxolan-2-yloxy)phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate (PubChem CID 18945731) has the molecular formula C28H29F3O7S2 and a molecular weight of 598.66 g/mol. Its IUPAC name is bis[4-(oxolan-2-yloxy)phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate.
| Compound Name | bis[4-(oxolan-2-yloxy)phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 18945731 |
| Molecular Formula | C28H29F3O7S2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | bis[4-(oxolan-2-yloxy)phenyl]-phenylsulfanium;2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)([O-])CC(F)(F)F.c1ccc([S+](c2ccc(OC3CCCO3)cc2)c2ccc(OC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C26H27O4S.C2H3F3O3S/c1-2-6-22(7-3-1)31(23-14-10-20(11-15-23)29-25-8-4-18-27-25)24-16-12-21(13-17-24)30-26-9-5-19-28-26;3-2(4,5)1-9(6,7)8/h1-3,6-7,10-17,25-26H,4-5,8-9,18-19H2;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | KXRQXVBFYOTAJD-UHFFFAOYSA-M |
| XLogP | 5.91 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|