C30H37F3N2O6S2 — CID 18945779
bis[4-(dimethylamino)phenyl]-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,2,2-trifluoroethanesulfonate (PubChem CID 18945779) has the molecular formula C30H37F3N2O6S2 and a molecular weight of 642.76 g/mol. Its IUPAC name is bis[4-(dimethylamino)phenyl]-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,2,2-trifluoroethanesulfonate.
| Compound Name | bis[4-(dimethylamino)phenyl]-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 18945779 |
| Molecular Formula | C30H37F3N2O6S2 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | bis[4-(dimethylamino)phenyl]-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium;2,2,2-trifluoroethanesulfonate |
| SMILES | CN(C)c1ccc([S+](c2ccc(N(C)C)cc2)c2cccc(OCC(=O)OC(C)(C)C)c2)cc1.O=S(=O)([O-])CC(F)(F)F |
| InChI | InChI=1S/C28H35N2O3S.C2H3F3O3S/c1-28(2,3)33-27(31)20-32-23-9-8-10-26(19-23)34(24-15-11-21(12-16-24)29(4)5)25-17-13-22(14-18-25)30(6)7;3-2(4,5)1-9(6,7)8/h8-19H,20H2,1-7H3;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | FQEBNLKGZQOCPB-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|