About 1-benzylazepan-4-amine
1-benzylazepan-4-amine (PubChem CID 18946188) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-benzylazepan-4-amine.
Molecular Properties
| Compound Name | 1-benzylazepan-4-amine |
| PubChem CID | 18946188 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-benzylazepan-4-amine |
| SMILES | NC1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H20N2/c14-13-7-4-9-15(10-8-13)11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,14H2 |
| InChIKey | AWOBBFYDHSJOIL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylazepan-4-amine?
The IUPAC name of 1-benzylazepan-4-amine (CID 18946188) is 1-benzylazepan-4-amine.
What is the SMILES notation for 1-benzylazepan-4-amine?
The canonical SMILES for 1-benzylazepan-4-amine is NC1CCCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzylazepan-4-amine?
The InChIKey is AWOBBFYDHSJOIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c14-13-7-4-9-15(10-8-13)11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,14H2.
What are the key properties of 1-benzylazepan-4-amine?
1-benzylazepan-4-amine has a molecular weight of 204.32 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylazepan-4-amine is sourced from PubChem (CID 18946188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).