About 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine
4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine (PubChem CID 18946586) has the molecular formula C18H20FNO3S
and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine |
| PubChem CID | 18946586 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine |
| SMILES | CC1NC(c2ccc(F)cc2)C(C)(c2ccc(S(C)(=O)=O)cc2)O1 |
| InChI | InChI=1S/C18H20FNO3S/c1-12-20-17(13-4-8-15(19)9-5-13)18(2,23-12)14-6-10-16(11-7-14)24(3,21)22/h4-12,17,20H,1-3H3 |
| InChIKey | XZYWOMJMMXPBJJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine?
The IUPAC name of 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine (CID 18946586) is 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine.
What is the SMILES notation for 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine?
The canonical SMILES for 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine is CC1NC(c2ccc(F)cc2)C(C)(c2ccc(S(C)(=O)=O)cc2)O1.
What is the InChIKey of 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine?
The InChIKey is XZYWOMJMMXPBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO3S/c1-12-20-17(13-4-8-15(19)9-5-13)18(2,23-12)14-6-10-16(11-7-14)24(3,21)22/h4-12,17,20H,1-3H3.
What are the key properties of 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine?
4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine has a molecular weight of 349.43 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-2,5-dimethyl-5-(4-methylsulfonylphenyl)-1,3-oxazolidine is sourced from PubChem (CID 18946586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).