C34H32N4O5 — CID 18947110
3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)-6-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 18947110) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)-6-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)-6-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18947110 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 3-[1-(2-hydroxy-3-morpholin-4-ylpropyl)-6-phenylmethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CC(O)CN3CCOCC3)c3cc(OCc4ccccc4)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C34H32N4O5/c39-23(18-37-12-14-42-15-13-37)19-38-20-28(26-11-10-24(16-30(26)38)43-21-22-6-2-1-3-7-22)32-31(33(40)36-34(32)41)27-17-35-29-9-5-4-8-25(27)29/h1-11,16-17,20,23,35,39H,12-15,18-19,21H2,(H,36,40,41) |
| InChIKey | GJHWFHPCCPCNFB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|