C26H21N5O6S — CID 18947181
3-[7-[4-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2,5-dioxopyrrol-3-yl]-[1,3]dioxolo[4,5-f]indol-5-yl]propyl carbamimidothioate (PubChem CID 18947181) has the molecular formula C26H21N5O6S and a molecular weight of 531.55 g/mol. Its IUPAC name is 3-[7-[4-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2,5-dioxopyrrol-3-yl]-[1,3]dioxolo[4,5-f]indol-5-yl]propyl carbamimidothioate.
| Compound Name | 3-[7-[4-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2,5-dioxopyrrol-3-yl]-[1,3]dioxolo[4,5-f]indol-5-yl]propyl carbamimidothioate |
|---|---|
| PubChem CID | 18947181 |
| Molecular Formula | C26H21N5O6S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 3-[7-[4-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2,5-dioxopyrrol-3-yl]-[1,3]dioxolo[4,5-f]indol-5-yl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCn1cc(C2=C(c3c[nH]c4cc5c(cc34)OCO5)C(=O)NC2=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C26H21N5O6S/c27-26(28)38-3-1-2-31-9-15(13-5-19-21(7-17(13)31)37-11-35-19)23-22(24(32)30-25(23)33)14-8-29-16-6-20-18(4-12(14)16)34-10-36-20/h4-9,29H,1-3,10-11H2,(H3,27,28)(H,30,32,33) |
| InChIKey | AJDAUMRDSQVTTK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|