C11H4F21NO2S — CID 18947356
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluoro-N-methyldecane-1-sulfonamide (PubChem CID 18947356) has the molecular formula C11H4F21NO2S and a molecular weight of 613.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluoro-N-methyldecane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluoro-N-methyldecane-1-sulfonamide |
|---|---|
| PubChem CID | 18947356 |
| Molecular Formula | C11H4F21NO2S |
| Molecular Weight | 613.18 g/mol |
| Exact Mass | 612.96 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluoro-N-methyldecane-1-sulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F21NO2S/c1-33-36(34,35)11(31,32)9(26,27)7(22,23)5(18,19)3(14,15)2(12,13)4(16,17)6(20,21)8(24,25)10(28,29)30/h33H,1H3 |
| InChIKey | AYBGRXUELWRNSY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.18 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|