C39H56N2O5 — CID 18947645
5-[[cyclohexyl-[[4-(2,2-dimethylpropyl)phenyl]methyl]amino]-(3,5-ditert-butyl-4-hydroxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 18947645) has the molecular formula C39H56N2O5 and a molecular weight of 632.89 g/mol. Its IUPAC name is 5-[[cyclohexyl-[[4-(2,2-dimethylpropyl)phenyl]methyl]amino]-(3,5-ditert-butyl-4-hydroxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[cyclohexyl-[[4-(2,2-dimethylpropyl)phenyl]methyl]amino]-(3,5-ditert-butyl-4-hydroxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 18947645 |
| Molecular Formula | C39H56N2O5 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.42 |
| IUPAC Name | 5-[[cyclohexyl-[[4-(2,2-dimethylpropyl)phenyl]methyl]amino]-(3,5-ditert-butyl-4-hydroxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)(C)Cc1ccc(CN(C(Nc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)=C2C(=O)OC(C)(C)OC2=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C39H56N2O5/c1-36(2,3)23-25-17-19-26(20-18-25)24-41(28-15-13-12-14-16-28)33(31-34(43)45-39(10,11)46-35(31)44)40-27-21-29(37(4,5)6)32(42)30(22-27)38(7,8)9/h17-22,28,40,42H,12-16,23-24H2,1-11H3 |
| InChIKey | CBOUIJFYMJSVKU-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|