C40H60N2O5 — CID 18947648
5-[(3,5-ditert-butyl-4-hydroxyanilino)-[[4-(2,2-dimethylpropyl)phenyl]methyl-heptan-2-ylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 18947648) has the molecular formula C40H60N2O5 and a molecular weight of 648.93 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-4-hydroxyanilino)-[[4-(2,2-dimethylpropyl)phenyl]methyl-heptan-2-ylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3,5-ditert-butyl-4-hydroxyanilino)-[[4-(2,2-dimethylpropyl)phenyl]methyl-heptan-2-ylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 18947648 |
| Molecular Formula | C40H60N2O5 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.45 |
| IUPAC Name | 5-[(3,5-ditert-butyl-4-hydroxyanilino)-[[4-(2,2-dimethylpropyl)phenyl]methyl-heptan-2-ylamino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCCC(C)N(Cc1ccc(CC(C)(C)C)cc1)C(Nc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C40H60N2O5/c1-14-15-16-17-26(2)42(25-28-20-18-27(19-21-28)24-37(3,4)5)34(32-35(44)46-40(12,13)47-36(32)45)41-29-22-30(38(6,7)8)33(43)31(23-29)39(9,10)11/h18-23,26,41,43H,14-17,24-25H2,1-13H3 |
| InChIKey | VAHJCIJUTSZRFO-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|