About N,N-dibutylcarbamoyl bromide
N,N-dibutylcarbamoyl bromide (PubChem CID 18947661) has the molecular formula C9H18BrNO
and a molecular weight of 236.15 g/mol. Its IUPAC name is N,N-dibutylcarbamoyl bromide.
Molecular Properties
| Compound Name | N,N-dibutylcarbamoyl bromide |
| PubChem CID | 18947661 |
| Molecular Formula | C9H18BrNO |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N,N-dibutylcarbamoyl bromide |
| SMILES | CCCCN(CCCC)C(=O)Br |
| InChI | InChI=1S/C9H18BrNO/c1-3-5-7-11(9(10)12)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | QWULLYSVWIHTKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutylcarbamoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylcarbamoyl bromide?
The IUPAC name of N,N-dibutylcarbamoyl bromide (CID 18947661) is N,N-dibutylcarbamoyl bromide.
What is the SMILES notation for N,N-dibutylcarbamoyl bromide?
The canonical SMILES for N,N-dibutylcarbamoyl bromide is CCCCN(CCCC)C(=O)Br.
What is the InChIKey of N,N-dibutylcarbamoyl bromide?
The InChIKey is QWULLYSVWIHTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BrNO/c1-3-5-7-11(9(10)12)8-6-4-2/h3-8H2,1-2H3.
What are the key properties of N,N-dibutylcarbamoyl bromide?
N,N-dibutylcarbamoyl bromide has a molecular weight of 236.15 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylcarbamoyl bromide is sourced from PubChem (CID 18947661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).