About (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile
(E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile (PubChem CID 18947719) has the molecular formula C12H5Cl2F3N4
and a molecular weight of 333.10 g/mol. Its IUPAC name is (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile.
Molecular Properties
| Compound Name | (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile |
| PubChem CID | 18947719 |
| Molecular Formula | C12H5Cl2F3N4 |
| Molecular Weight | 333.10 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile |
| SMILES | N#C/C(N)=C(C#N)\N=C\c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H5Cl2F3N4/c13-8-1-6(12(15,16)17)2-9(14)7(8)5-21-11(4-19)10(20)3-18/h1-2,5H,20H2/b11-10+,21-5+ |
| InChIKey | CGHLUWMJUBASRQ-CBBCJDSKSA-N |
| XLogP | 3.65 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.10 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile?
The IUPAC name of (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile (CID 18947719) is (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile.
What is the SMILES notation for (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile?
The canonical SMILES for (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile is N#C/C(N)=C(C#N)\N=C\c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile?
The InChIKey is CGHLUWMJUBASRQ-CBBCJDSKSA-N. The full InChI is InChI=1S/C12H5Cl2F3N4/c13-8-1-6(12(15,16)17)2-9(14)7(8)5-21-11(4-19)10(20)3-18/h1-2,5H,20H2/b11-10+,21-5+.
What are the key properties of (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile?
(E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile has a molecular weight of 333.10 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-amino-3-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methylideneamino]but-2-enedinitrile is sourced from PubChem (CID 18947719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).