C28H33N3O9 — CID 18947725
[4-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-4-oxobutanimidoyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 18947725) has the molecular formula C28H33N3O9 and a molecular weight of 555.58 g/mol. Its IUPAC name is [4-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-4-oxobutanimidoyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | [4-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-4-oxobutanimidoyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18947725 |
| Molecular Formula | C28H33N3O9 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | [4-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-4-oxobutanimidoyl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\CCC(=O)OC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)OC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C28H33N3O9/c29-21(39-27(37)19-5-1-17(2-6-19)15-30-22(32)10-11-23(30)33)9-14-26(36)40-28(38)20-7-3-18(4-8-20)16-31-24(34)12-13-25(31)35/h10-13,17-20,29H,1-9,14-16H2/b29-21+ |
| InChIKey | VFUMDZQUGWCLOP-XHLNEMQHSA-N |
| XLogP | 1.82 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|