About heptane-1,2-diamine
heptane-1,2-diamine (PubChem CID 18947827) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is heptane-1,2-diamine.
Molecular Properties
| Compound Name | heptane-1,2-diamine |
| PubChem CID | 18947827 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | heptane-1,2-diamine |
| SMILES | CCCCCC(N)CN |
| InChI | InChI=1S/C7H18N2/c1-2-3-4-5-7(9)6-8/h7H,2-6,8-9H2,1H3 |
| InChIKey | PGGXMTDBCVGBLO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-1,2-diamine?
The IUPAC name of heptane-1,2-diamine (CID 18947827) is heptane-1,2-diamine.
What is the SMILES notation for heptane-1,2-diamine?
The canonical SMILES for heptane-1,2-diamine is CCCCCC(N)CN.
What is the InChIKey of heptane-1,2-diamine?
The InChIKey is PGGXMTDBCVGBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2/c1-2-3-4-5-7(9)6-8/h7H,2-6,8-9H2,1H3.
What are the key properties of heptane-1,2-diamine?
heptane-1,2-diamine has a molecular weight of 130.23 g/mol, XLogP of 0.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-1,2-diamine is sourced from PubChem (CID 18947827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).