About 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol
6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol (PubChem CID 18948930) has the molecular formula C18H25FN2O2
and a molecular weight of 320.41 g/mol. Its IUPAC name is 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol.
Molecular Properties
| Compound Name | 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol |
| PubChem CID | 18948930 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol |
| SMILES | OCCCCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C18H25FN2O2/c19-15-5-6-16-17(13-15)23-20-18(16)14-7-10-21(11-8-14)9-3-1-2-4-12-22/h5-6,13-14,22H,1-4,7-12H2 |
| InChIKey | VQKMCZNVRYZPOW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol?
The IUPAC name of 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol (CID 18948930) is 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol.
What is the SMILES notation for 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol?
The canonical SMILES for 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol is OCCCCCCN1CCC(c2noc3cc(F)ccc23)CC1.
What is the InChIKey of 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol?
The InChIKey is VQKMCZNVRYZPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25FN2O2/c19-15-5-6-16-17(13-15)23-20-18(16)14-7-10-21(11-8-14)9-3-1-2-4-12-22/h5-6,13-14,22H,1-4,7-12H2.
What are the key properties of 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol?
6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol has a molecular weight of 320.41 g/mol, XLogP of 3.70, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]hexan-1-ol is sourced from PubChem (CID 18948930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).