About 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol
6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 18949041) has the molecular formula C13H12BrNOS
and a molecular weight of 310.22 g/mol. Its IUPAC name is 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol.
Molecular Properties
| Compound Name | 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol |
| PubChem CID | 18949041 |
| Molecular Formula | C13H12BrNOS |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(c2ccns2)CCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H12BrNOS/c14-10-3-4-11-9(8-10)2-1-6-13(11,16)12-5-7-15-17-12/h3-5,7-8,16H,1-2,6H2 |
| InChIKey | JOXFBTBELOBCRM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol?
The IUPAC name of 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol (CID 18949041) is 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol.
What is the SMILES notation for 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol?
The canonical SMILES for 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol is OC1(c2ccns2)CCCc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol?
The InChIKey is JOXFBTBELOBCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNOS/c14-10-3-4-11-9(8-10)2-1-6-13(11,16)12-5-7-15-17-12/h3-5,7-8,16H,1-2,6H2.
What are the key properties of 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol?
6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol has a molecular weight of 310.22 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-(1,2-thiazol-5-yl)-3,4-dihydro-2H-naphthalen-1-ol is sourced from PubChem (CID 18949041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).