About bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol
bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol (PubChem CID 18949045) has the molecular formula C19H12Br2N2OS2
and a molecular weight of 508.26 g/mol. Its IUPAC name is bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol |
| PubChem CID | 18949045 |
| Molecular Formula | C19H12Br2N2OS2 |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 505.88 |
| IUPAC Name | bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol |
| SMILES | OC(c1sncc1-c1ccc(Br)cc1)c1sncc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H12Br2N2OS2/c20-13-5-1-11(2-6-13)15-9-22-25-18(15)17(24)19-16(10-23-26-19)12-3-7-14(21)8-4-12/h1-10,17,24H |
| InChIKey | VSPCECZNDBCBLV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol?
The IUPAC name of bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol (CID 18949045) is bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol.
What is the SMILES notation for bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol?
The canonical SMILES for bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol is OC(c1sncc1-c1ccc(Br)cc1)c1sncc1-c1ccc(Br)cc1.
What is the InChIKey of bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol?
The InChIKey is VSPCECZNDBCBLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Br2N2OS2/c20-13-5-1-11(2-6-13)15-9-22-25-18(15)17(24)19-16(10-23-26-19)12-3-7-14(21)8-4-12/h1-10,17,24H.
What are the key properties of bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol?
bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol has a molecular weight of 508.26 g/mol, XLogP of 6.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(4-bromophenyl)-1,2-thiazol-5-yl]methanol is sourced from PubChem (CID 18949045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).