About Monomethyl trisilanol
Monomethyl trisilanol (PubChem CID 18949353) has the molecular formula CH4OSi3
and a molecular weight of 116.30 g/mol.
Molecular Properties
| Compound Name | Monomethyl trisilanol |
| PubChem CID | 18949353 |
| Molecular Formula | CH4OSi3 |
| Molecular Weight | 116.30 g/mol |
| Exact Mass | 115.96 |
| IUPAC Name | — |
| SMILES | C[Si](O)[Si][Si] |
| InChI | InChI=1S/CH4OSi3/c1-5(2)4-3/h2H,1H3 |
| InChIKey | VCGPDCPYQVFCNI-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Monomethyl trisilanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Monomethyl trisilanol?
The IUPAC name of Monomethyl trisilanol (CID 18949353) is not available.
What is the SMILES notation for Monomethyl trisilanol?
The canonical SMILES for Monomethyl trisilanol is C[Si](O)[Si][Si].
What is the InChIKey of Monomethyl trisilanol?
The InChIKey is VCGPDCPYQVFCNI-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4OSi3/c1-5(2)4-3/h2H,1H3.
What are the key properties of Monomethyl trisilanol?
Monomethyl trisilanol has a molecular weight of 116.30 g/mol, XLogP of -1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Monomethyl trisilanol is sourced from PubChem (CID 18949353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).