C51H48O6 — CID 18949647
4-[[4-hydroxy-3,5-bis[(2-hydroxy-5-methylphenyl)methyl]phenyl]-phenylmethyl]-2,6-bis[(2-hydroxy-5-methylphenyl)methyl]phenol (PubChem CID 18949647) has the molecular formula C51H48O6 and a molecular weight of 756.94 g/mol. Its IUPAC name is 4-[[4-hydroxy-3,5-bis[(2-hydroxy-5-methylphenyl)methyl]phenyl]-phenylmethyl]-2,6-bis[(2-hydroxy-5-methylphenyl)methyl]phenol.
| Compound Name | 4-[[4-hydroxy-3,5-bis[(2-hydroxy-5-methylphenyl)methyl]phenyl]-phenylmethyl]-2,6-bis[(2-hydroxy-5-methylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 18949647 |
| Molecular Formula | C51H48O6 |
| Molecular Weight | 756.94 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | 4-[[4-hydroxy-3,5-bis[(2-hydroxy-5-methylphenyl)methyl]phenyl]-phenylmethyl]-2,6-bis[(2-hydroxy-5-methylphenyl)methyl]phenol |
| SMILES | Cc1ccc(O)c(Cc2cc(C(c3ccccc3)c3cc(Cc4cc(C)ccc4O)c(O)c(Cc4cc(C)ccc4O)c3)cc(Cc3cc(C)ccc3O)c2O)c1 |
| InChI | InChI=1S/C51H48O6/c1-30-10-14-45(52)35(18-30)22-41-26-39(27-42(50(41)56)23-36-19-31(2)11-15-46(36)53)49(34-8-6-5-7-9-34)40-28-43(24-37-20-32(3)12-16-47(37)54)51(57)44(29-40)25-38-21-33(4)13-17-48(38)55/h5-21,26-29,49,52-57H,22-25H2,1-4H3 |
| InChIKey | YPRBEPXEIDDXPN-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.94 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|