C17H33N3 — CID 18949780
2-(2-methyl-3-octylpyrrolidin-1-yl)-1,2,3,4-tetrahydropyrimidine (PubChem CID 18949780) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 2-(2-methyl-3-octylpyrrolidin-1-yl)-1,2,3,4-tetrahydropyrimidine.
| Compound Name | 2-(2-methyl-3-octylpyrrolidin-1-yl)-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 18949780 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 2-(2-methyl-3-octylpyrrolidin-1-yl)-1,2,3,4-tetrahydropyrimidine |
| SMILES | CCCCCCCCC1CCN(C2NC=CCN2)C1C |
| InChI | InChI=1S/C17H33N3/c1-3-4-5-6-7-8-10-16-11-14-20(15(16)2)17-18-12-9-13-19-17/h9,12,15-19H,3-8,10-11,13-14H2,1-2H3 |
| InChIKey | JRUVZLHLQMSHOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|