About 1-amino-2-butylguanidine;hydrochloride
1-amino-2-butylguanidine;hydrochloride (PubChem CID 18949986) has the molecular formula C5H15ClN4
and a molecular weight of 166.66 g/mol. Its IUPAC name is 1-amino-2-butylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 1-amino-2-butylguanidine;hydrochloride |
| PubChem CID | 18949986 |
| Molecular Formula | C5H15ClN4 |
| Molecular Weight | 166.66 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-amino-2-butylguanidine;hydrochloride |
| SMILES | CCCC/N=C(\N)NN.Cl |
| InChI | InChI=1S/C5H14N4.ClH/c1-2-3-4-8-5(6)9-7;/h2-4,7H2,1H3,(H3,6,8,9);1H |
| InChIKey | UGTQUJHNCHJDKT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.66 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-butylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-butylguanidine;hydrochloride?
The IUPAC name of 1-amino-2-butylguanidine;hydrochloride (CID 18949986) is 1-amino-2-butylguanidine;hydrochloride.
What is the SMILES notation for 1-amino-2-butylguanidine;hydrochloride?
The canonical SMILES for 1-amino-2-butylguanidine;hydrochloride is CCCC/N=C(\N)NN.Cl.
What is the InChIKey of 1-amino-2-butylguanidine;hydrochloride?
The InChIKey is UGTQUJHNCHJDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4.ClH/c1-2-3-4-8-5(6)9-7;/h2-4,7H2,1H3,(H3,6,8,9);1H.
What are the key properties of 1-amino-2-butylguanidine;hydrochloride?
1-amino-2-butylguanidine;hydrochloride has a molecular weight of 166.66 g/mol, XLogP of -0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-butylguanidine;hydrochloride is sourced from PubChem (CID 18949986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).