C11H9F13O — CID 18950092
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane (PubChem CID 18950092) has the molecular formula C11H9F13O and a molecular weight of 404.17 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane |
|---|---|
| PubChem CID | 18950092 |
| Molecular Formula | C11H9F13O |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)oxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCO1 |
| InChI | InChI=1S/C11H9F13O/c12-6(13,5-3-1-2-4-25-5)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h5H,1-4H2 |
| InChIKey | KDYOMFOKUGAAHG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|