About 1-butyl-1,3,3-trimethylguanidine
1-butyl-1,3,3-trimethylguanidine (PubChem CID 18952266) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is 1-butyl-1,3,3-trimethylguanidine.
Molecular Properties
| Compound Name | 1-butyl-1,3,3-trimethylguanidine |
| PubChem CID | 18952266 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 1-butyl-1,3,3-trimethylguanidine |
| SMILES | [H]/N=C(\N(C)C)N(C)CCCC |
| InChI | InChI=1S/C8H19N3/c1-5-6-7-11(4)8(9)10(2)3/h9H,5-7H2,1-4H3/b9-8+ |
| InChIKey | DVPBRSGVCXHBQR-CMDGGOBGSA-N |
| XLogP | 1.21 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1,3,3-trimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1,3,3-trimethylguanidine?
The IUPAC name of 1-butyl-1,3,3-trimethylguanidine (CID 18952266) is 1-butyl-1,3,3-trimethylguanidine.
What is the SMILES notation for 1-butyl-1,3,3-trimethylguanidine?
The canonical SMILES for 1-butyl-1,3,3-trimethylguanidine is [H]/N=C(\N(C)C)N(C)CCCC.
What is the InChIKey of 1-butyl-1,3,3-trimethylguanidine?
The InChIKey is DVPBRSGVCXHBQR-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H19N3/c1-5-6-7-11(4)8(9)10(2)3/h9H,5-7H2,1-4H3/b9-8+.
What are the key properties of 1-butyl-1,3,3-trimethylguanidine?
1-butyl-1,3,3-trimethylguanidine has a molecular weight of 157.26 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1,3,3-trimethylguanidine is sourced from PubChem (CID 18952266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).