About N'-methylpentanimidamide
N'-methylpentanimidamide (PubChem CID 18952276) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N'-methylpentanimidamide.
Molecular Properties
| Compound Name | N'-methylpentanimidamide |
| PubChem CID | 18952276 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N'-methylpentanimidamide |
| SMILES | CCCC/C(N)=N\C |
| InChI | InChI=1S/C6H14N2/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3,(H2,7,8) |
| InChIKey | ILZGWBDPYGSWSC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylpentanimidamide?
The IUPAC name of N'-methylpentanimidamide (CID 18952276) is N'-methylpentanimidamide.
What is the SMILES notation for N'-methylpentanimidamide?
The canonical SMILES for N'-methylpentanimidamide is CCCC/C(N)=N\C.
What is the InChIKey of N'-methylpentanimidamide?
The InChIKey is ILZGWBDPYGSWSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3,(H2,7,8).
What are the key properties of N'-methylpentanimidamide?
N'-methylpentanimidamide has a molecular weight of 114.19 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylpentanimidamide is sourced from PubChem (CID 18952276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).