C18H26N2O2 — CID 18952407
N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)heptanamide (PubChem CID 18952407) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)heptanamide.
| Compound Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)heptanamide |
|---|---|
| PubChem CID | 18952407 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc2c(c1)NC(=O)CC2(C)C |
| InChI | InChI=1S/C18H26N2O2/c1-4-5-6-7-8-16(21)19-13-9-10-14-15(11-13)20-17(22)12-18(14,2)3/h9-11H,4-8,12H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | NORCIHKYBBALLO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|