C24H30N2O2 — CID 18952417
4-tert-butyl-N-(4,4-diethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide (PubChem CID 18952417) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-tert-butyl-N-(4,4-diethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(4,4-diethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 18952417 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-tert-butyl-N-(4,4-diethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide |
| SMILES | CCC1(CC)CC(=O)Nc2cc(NC(=O)c3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C24H30N2O2/c1-6-24(7-2)15-21(27)26-20-14-18(12-13-19(20)24)25-22(28)16-8-10-17(11-9-16)23(3,4)5/h8-14H,6-7,15H2,1-5H3,(H,25,28)(H,26,27) |
| InChIKey | QZAMJUMJROGJMX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |