About pyrrolo[3,2-f]benzimidazole
pyrrolo[3,2-f]benzimidazole (PubChem CID 18952429) has the molecular formula C9H5N3
and a molecular weight of 155.16 g/mol. Its IUPAC name is pyrrolo[3,2-f]benzimidazole.
Molecular Properties
| Compound Name | pyrrolo[3,2-f]benzimidazole |
| PubChem CID | 18952429 |
| Molecular Formula | C9H5N3 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | pyrrolo[3,2-f]benzimidazole |
| SMILES | C1=Cc2cc3c(cc2=N1)N=CN=3 |
| InChI | InChI=1S/C9H5N3/c1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-5H |
| InChIKey | NCZRDFQABAXZJI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[3,2-f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,2-f]benzimidazole?
The IUPAC name of pyrrolo[3,2-f]benzimidazole (CID 18952429) is pyrrolo[3,2-f]benzimidazole.
What is the SMILES notation for pyrrolo[3,2-f]benzimidazole?
The canonical SMILES for pyrrolo[3,2-f]benzimidazole is C1=Cc2cc3c(cc2=N1)N=CN=3.
What is the InChIKey of pyrrolo[3,2-f]benzimidazole?
The InChIKey is NCZRDFQABAXZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3/c1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-5H.
What are the key properties of pyrrolo[3,2-f]benzimidazole?
pyrrolo[3,2-f]benzimidazole has a molecular weight of 155.16 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,2-f]benzimidazole is sourced from PubChem (CID 18952429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).