About 1-(diethylamino)ethyl hypofluorite
1-(diethylamino)ethyl hypofluorite (PubChem CID 18952774) has the molecular formula C6H14FNO
and a molecular weight of 135.18 g/mol. Its IUPAC name is 1-(diethylamino)ethyl hypofluorite.
Molecular Properties
| Compound Name | 1-(diethylamino)ethyl hypofluorite |
| PubChem CID | 18952774 |
| Molecular Formula | C6H14FNO |
| Molecular Weight | 135.18 g/mol |
| Exact Mass | 135.11 |
| IUPAC Name | 1-(diethylamino)ethyl hypofluorite |
| SMILES | CCN(CC)C(C)OF |
| InChI | InChI=1S/C6H14FNO/c1-4-8(5-2)6(3)9-7/h6H,4-5H2,1-3H3 |
| InChIKey | FWDGGSRSRKITFD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethylamino)ethyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)ethyl hypofluorite?
The IUPAC name of 1-(diethylamino)ethyl hypofluorite (CID 18952774) is 1-(diethylamino)ethyl hypofluorite.
What is the SMILES notation for 1-(diethylamino)ethyl hypofluorite?
The canonical SMILES for 1-(diethylamino)ethyl hypofluorite is CCN(CC)C(C)OF.
What is the InChIKey of 1-(diethylamino)ethyl hypofluorite?
The InChIKey is FWDGGSRSRKITFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14FNO/c1-4-8(5-2)6(3)9-7/h6H,4-5H2,1-3H3.
What are the key properties of 1-(diethylamino)ethyl hypofluorite?
1-(diethylamino)ethyl hypofluorite has a molecular weight of 135.18 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)ethyl hypofluorite is sourced from PubChem (CID 18952774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).