About (4-hydroxythiolan-3-yl) heptanoate
(4-hydroxythiolan-3-yl) heptanoate (PubChem CID 18952919) has the molecular formula C11H20O3S
and a molecular weight of 232.34 g/mol. Its IUPAC name is (4-hydroxythiolan-3-yl) heptanoate.
Molecular Properties
| Compound Name | (4-hydroxythiolan-3-yl) heptanoate |
| PubChem CID | 18952919 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (4-hydroxythiolan-3-yl) heptanoate |
| SMILES | CCCCCCC(=O)OC1CSCC1O |
| InChI | InChI=1S/C11H20O3S/c1-2-3-4-5-6-11(13)14-10-8-15-7-9(10)12/h9-10,12H,2-8H2,1H3 |
| InChIKey | RFWKDTWWZZSFRT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxythiolan-3-yl) heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxythiolan-3-yl) heptanoate?
The IUPAC name of (4-hydroxythiolan-3-yl) heptanoate (CID 18952919) is (4-hydroxythiolan-3-yl) heptanoate.
What is the SMILES notation for (4-hydroxythiolan-3-yl) heptanoate?
The canonical SMILES for (4-hydroxythiolan-3-yl) heptanoate is CCCCCCC(=O)OC1CSCC1O.
What is the InChIKey of (4-hydroxythiolan-3-yl) heptanoate?
The InChIKey is RFWKDTWWZZSFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3S/c1-2-3-4-5-6-11(13)14-10-8-15-7-9(10)12/h9-10,12H,2-8H2,1H3.
What are the key properties of (4-hydroxythiolan-3-yl) heptanoate?
(4-hydroxythiolan-3-yl) heptanoate has a molecular weight of 232.34 g/mol, XLogP of 1.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxythiolan-3-yl) heptanoate is sourced from PubChem (CID 18952919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).