About propan-2-yl 2-isocyanoacetate
propan-2-yl 2-isocyanoacetate (PubChem CID 18953452) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is propan-2-yl 2-isocyanoacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-isocyanoacetate |
| PubChem CID | 18953452 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | propan-2-yl 2-isocyanoacetate |
| SMILES | [C-]#[N+]CC(=O)OC(C)C |
| InChI | InChI=1S/C6H9NO2/c1-5(2)9-6(8)4-7-3/h5H,4H2,1-2H3 |
| InChIKey | ALNIEXDQXDKTMZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-isocyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-isocyanoacetate?
The IUPAC name of propan-2-yl 2-isocyanoacetate (CID 18953452) is propan-2-yl 2-isocyanoacetate.
What is the SMILES notation for propan-2-yl 2-isocyanoacetate?
The canonical SMILES for propan-2-yl 2-isocyanoacetate is [C-]#[N+]CC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-isocyanoacetate?
The InChIKey is ALNIEXDQXDKTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-5(2)9-6(8)4-7-3/h5H,4H2,1-2H3.
What are the key properties of propan-2-yl 2-isocyanoacetate?
propan-2-yl 2-isocyanoacetate has a molecular weight of 127.14 g/mol, XLogP of 0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-isocyanoacetate is sourced from PubChem (CID 18953452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).