About ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate
ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate (PubChem CID 18953633) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate |
| PubChem CID | 18953633 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)N1Cc2ccncc2C1 |
| InChI | InChI=1S/C10H12N2O2/c1-2-14-10(13)12-6-8-3-4-11-5-9(8)7-12/h3-5H,2,6-7H2,1H3 |
| InChIKey | NXDYQBHSITTWJS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate?
The IUPAC name of ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate (CID 18953633) is ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate?
The canonical SMILES for ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate is CCOC(=O)N1Cc2ccncc2C1.
What is the InChIKey of ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate?
The InChIKey is NXDYQBHSITTWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-2-14-10(13)12-6-8-3-4-11-5-9(8)7-12/h3-5H,2,6-7H2,1H3.
What are the key properties of ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate?
ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate has a molecular weight of 192.22 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate is sourced from PubChem (CID 18953633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).