C10H12N6O2S2 — CID 18953776
N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-hydroxyacetamide (PubChem CID 18953776) has the molecular formula C10H12N6O2S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-hydroxyacetamide.
| Compound Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 18953776 |
| Molecular Formula | C10H12N6O2S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-hydroxyacetamide |
| SMILES | NC(N)=Nc1nc(-c2csc(CNC(=O)CO)n2)cs1 |
| InChI | InChI=1S/C10H12N6O2S2/c11-9(12)16-10-15-6(4-20-10)5-3-19-8(14-5)1-13-7(18)2-17/h3-4,17H,1-2H2,(H,13,18)(H4,11,12,15,16) |
| InChIKey | KNYTVZMKIUWEJD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|